
CAS 117-56-6
:4-Hydroxy-1,5-naphthalenedisulfonic acid
Description:
4-Hydroxy-1,5-naphthalenedisulfonic acid, with the CAS number 117-56-6, is an organic compound characterized by its naphthalene structure, which features two sulfonic acid groups and a hydroxyl group. This compound is typically a solid at room temperature and is soluble in water due to the presence of the sulfonic acid groups, which enhance its polarity. It is often used as a dye intermediate and in the synthesis of various organic compounds. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as sulfonation and nitration. Additionally, 4-hydroxy-1,5-naphthalenedisulfonic acid exhibits properties that make it useful in analytical chemistry, particularly in the development of colorimetric assays. Its ability to form complexes with metal ions can also be exploited in various applications, including catalysis and material science. Safety data indicates that, like many sulfonic acids, it should be handled with care to avoid skin and eye irritation.
Formula:C10H8O7S2
InChI:InChI=1S/C10H8O7S2/c11-7-4-5-8(18(12,13)14)6-2-1-3-9(10(6)7)19(15,16)17/h1-5,11H,(H,12,13,14)(H,15,16,17)
InChI key:InChIKey=XIQKALDENTUXBY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(C(S(=O)(=O)O)=CC=C2)C(O)=CC1
Synonyms:- Schollkopf's acid
- 4-Hydroxy-1,5-naphthalenedisulfonic acid
- 1,5-Naphthalenedisulfonic acid, 4-hydroxy-
- 1-Naphthol-4,8-disulfonic acid
- Schoellkopf's acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
