CAS 117-68-0
:3′-GMP
Description:
3′-GMP, or guanosine monophosphate, is a nucleotide that plays a crucial role in various biological processes, including cellular signaling and energy transfer. It consists of a guanine base, a ribose sugar, and a phosphate group attached to the 3' position of the ribose. This compound is a key component of RNA and serves as a precursor for the synthesis of other nucleotides. In cellular signaling, 3′-GMP acts as a secondary messenger, particularly in pathways involving guanylate cyclase, which converts GTP to cGMP, influencing various physiological responses. The substance is soluble in water and exhibits a neutral pH in solution. Its stability can be affected by factors such as temperature and pH, and it can be hydrolyzed under certain conditions. 3′-GMP is also involved in the regulation of various enzymatic activities and is important in the synthesis of cyclic GMP, which is vital for vasodilation and neurotransmission. Overall, 3′-GMP is an essential molecule in biochemistry, contributing to the intricate network of cellular functions.
Formula:C10H14N5O8P
InChI:InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-5(17)6(3(1-16)22-9)23-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1
InChI key:InChIKey=ZDPUTNZENXVHJC-UUOKFMHZSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](CO)[C@H]1OP(=O)(O)O
Synonyms:- 2-amino-9-(3-O-phosphonopentofuranosyl)-3,9-dihydro-6H-purin-6-one
- 3'-Guanylic Acid
- 3′-Gmp
- Guanosine 3′-monophosphate
- Guanosine 3′-phosphate
- Guanylic Acid
- Guanosine 3′-(dihydrogen phosphate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
