CymitQuimica logo

CAS 117-70-4

:

Naphth[2,1-d]-1,2,3-oxadiazole-5-sulfonic acid

Description:
Naphth[2,1-d]-1,2,3-oxadiazole-5-sulfonic acid, with the CAS number 117-70-4, is a heterocyclic compound characterized by its oxadiazole ring fused to a naphthalene structure. This compound features a sulfonic acid group, which contributes to its solubility in water and enhances its reactivity. It typically appears as a crystalline solid and is known for its fluorescent properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. The presence of the sulfonic acid group also imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit biological activity, which has led to research into its potential applications in pharmaceuticals and materials science. Its unique structure and functional groups make it a subject of interest in organic synthesis and chemical research. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H6N2O4S
InChI:InChI=1S/C10H6N2O4S/c13-17(14,15)9-5-8-10(16-12-11-8)7-4-2-1-3-6(7)9/h1-5H,(H,13,14,15)
InChI key:InChIKey=OIDKWKZBMQUGNQ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(C3=C(C1)N=NO3)=CC=CC2
Synonyms:
  • Naphth[2,1-d]-1,2,3-oxadiazole-5-sulfonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.