CAS 117-71-5
:2′-Chloro[1,1′-biphenyl]-2,5-diol
Description:
2′-Chloro[1,1′-biphenyl]-2,5-diol, with the CAS number 117-71-5, is an organic compound characterized by its biphenyl structure substituted with a chlorine atom and hydroxyl groups. This compound features two hydroxyl (-OH) groups located at the 2 and 5 positions of the biphenyl framework, which contribute to its potential as a phenolic compound. The presence of the chlorine atom at the 2′ position enhances its reactivity and may influence its solubility and biological activity. Typically, compounds like this can exhibit various properties such as antioxidant activity, and they may be of interest in fields like pharmaceuticals, agrochemicals, or materials science. The molecular structure allows for potential hydrogen bonding due to the hydroxyl groups, which can affect its physical properties, including melting and boiling points, as well as its solubility in different solvents. Safety and handling precautions should be observed, as with many chlorinated organic compounds, due to potential toxicity and environmental concerns.
Formula:C12H9ClO2
InChI:InChI=1S/C12H9ClO2/c13-11-4-2-1-3-9(11)10-7-8(14)5-6-12(10)15/h1-7,14-15H
InChI key:InChIKey=XRKJFSFMYUQOSD-UHFFFAOYSA-N
SMILES:OC1=C(C=C(O)C=C1)C2=C(Cl)C=CC=C2
Synonyms:- (1,1'-Biphenyl)-2,5-diol, 2'-chloro-
- (o-Chlorophenyl)hydroquinone
- 2'-Chlorobiphenyl-2,5-Diol
- 2-(2-Chlorophenyl)benzene-1,4-diol
- 2-(2-Chlorophenyl)hydroquinone
- Hydroquinone, (o-chlorophenyl)-
- 2'-Chloro(1,1'-biphenyl)-2,5-diol
- 2′-Chloro[1,1′-biphenyl]-2,5-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
