CAS 117-96-4: diatrizoic acid
Description:Diatrizoic acid, with the CAS number 117-96-4, is a chemical compound classified as a radiopaque agent, commonly used in medical imaging procedures such as X-rays and computed tomography (CT) scans. It is a white to off-white crystalline powder that is soluble in water, which facilitates its use in contrast media for enhancing the visibility of internal structures during imaging. The compound is a derivative of benzoic acid and contains iodine, which is responsible for its radiopacity. Diatrizoic acid is known for its low toxicity and is generally well-tolerated by patients, although some may experience allergic reactions. Its chemical structure includes multiple carboxylic acid groups, contributing to its solubility and interaction with biological tissues. Due to its properties, diatrizoic acid plays a crucial role in diagnostic radiology, allowing for clearer imaging of organs and blood vessels, thereby aiding in the diagnosis and treatment of various medical conditions.
Formula:C11H9I3N2O4
InChI:InChI=1S/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20)
InChI key:InChIKey=YVPYQUNUQOZFHG-UHFFFAOYSA-N
SMILES:O=C(O)C=1C(I)=C(NC(=O)C)C(I)=C(NC(=O)C)C1I
- Synonyms:
- 2,4,6-Triiodo-3,5-diacetamidobenzoic acid
- 3,5-Bis(Acetylamino)-2,4,6-Triiodobenzoic Acid
- 3,5-Diacetamido-2,4,6-Triiodbenzoesaure
- 3,5-Diacetamido-2,4,6-triiodobenzioc acid
- 3,5-Diacetamido-2,4,6-triiodobenzoic acid
- Acide 3,5-diacetamido-2,4,6-triiodobenzoique
- Acido 3,5-Diacetamido-2,4,6-Triiodobenzoico
- Amidotrizoic acid
- Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo-
- Benzoic acid, 3,5-diacetamido-2,4,6-triiodo-
- See more synonyms
- Diatrizoate
- Nsc 262168
- Odiston
- Urografin acid
- Urogranoic acid
- Urotrast
- Diatrizoic acid