CAS 117007-52-0

3-Iodo-7-aza-1H-azaindazole

Description:

3-Iodo-7-aza-1H-azaindazole is a heterocyclic compound that features a fused bicyclic structure containing nitrogen atoms, which contributes to its unique chemical properties. The presence of the iodo substituent at the 3-position enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The azaindazole framework is characterized by its aromaticity, which is a result of the delocalized π-electron system involving both carbon and nitrogen atoms. This compound may exhibit various physical properties such as solubility in organic solvents, and its reactivity can be influenced by the presence of the iodine atom, which can participate in nucleophilic substitution reactions. Additionally, the nitrogen atoms in the structure can engage in hydrogen bonding, potentially affecting its interactions with biological targets. Overall, 3-Iodo-7-aza-1H-azaindazole is a compound of interest for research in fields such as drug development and materials science due to its unique structural features and potential applications.

Formula: C₆H₄IN₃

InChI: InChI=1/C6H4IN3/c7-5-4-2-1-3-8-6(4)10-9-5/h1-3H,(H,8,9,10)

SMILES: c1cc2c(I)[nH]nc2nc1

Synonyms:

• 3-iodo-1H-pyrazolo[3,4-b]pyridine
• 1H-Pyrazolo[3,4-b]pyridine, 3-iodo-

1H-Pyrazolo[3,4-b]pyridine, 3-iodo-

CAS: 117007-52-0

Formula: C₆H₄IN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.0205

Ref: IN-DA000DK1

3-Iodo-1H-pyrazolo[3,4-b]pyridine

CAS: 117007-52-0

3-Iodo-1H-pyrazolo[3,4-b]pyridine

Formula: C₆H₄IN₃

Purity: 99%

Color and Shape: yellow solid

Molecular weight: 245.02g/mol

Ref: 54-OR305393

3-Iodo-1H-pyrazolo[3,4-b]pyridine

CAS: 117007-52-0

Formula: C₆H₄IN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.023

Ref: 10-F236666