
CAS 117009-98-0
:Phenylmethyl 4-(3-aminopropyl)-1-piperazinecarboxylate
Description:
Phenylmethyl 4-(3-aminopropyl)-1-piperazinecarboxylate, identified by its CAS number 117009-98-0, is a chemical compound that belongs to the class of piperazine derivatives. This substance typically exhibits characteristics such as being a white to off-white solid, with potential solubility in polar organic solvents. Its molecular structure features a piperazine ring, which is a six-membered nitrogen-containing heterocycle, and an aminoalkyl side chain that contributes to its biological activity. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and amidation. This compound may also exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on its conformation and the presence of functional groups, which can influence its binding affinity to biological targets. As with many piperazine derivatives, it may have applications in the development of pharmaceuticals, particularly in the fields of neuropharmacology and psychopharmacology.
Formula:C15H23N3O2
InChI:InChI=1S/C15H23N3O2/c16-7-4-8-17-9-11-18(12-10-17)15(19)20-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13,16H2
InChI key:InChIKey=BNRXWVARIROIGZ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CCN(CCCN)CC2
Synonyms:- Phenylmethyl 4-(3-aminopropyl)-1-piperazinecarboxylate
- 1-Piperazinecarboxylic acid, 4-(3-aminopropyl)-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Piperazinecarboxylic acid, 4-(3-aminopropyl)-, phenylmethyl ester
CAS:Formula:C15H23N3O2Molecular weight:277.362
