
CAS 117011-71-9
:9-(4-Chloro-1,2-butadien-1-yl)-9H-purin-6-amine
Description:
9-(4-Chloro-1,2-butadien-1-yl)-9H-purin-6-amine, with the CAS number 117011-71-9, is a chemical compound that belongs to the purine class of molecules, which are essential components of nucleic acids. This compound features a purine base structure, characterized by a fused double-ring system containing nitrogen atoms. The presence of a 4-chloro-1,2-butadienyl group at the 9-position of the purine ring introduces unique reactivity and potential biological activity. The chlorine atom and the conjugated diene system may influence the compound's interaction with biological targets, possibly affecting its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to its structural similarity to nucleobases. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a subject of study in various chemical and biological contexts. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C9H8ClN5
InChI:InChI=1S/C9H8ClN5/c10-3-1-2-4-15-6-14-7-8(11)12-5-13-9(7)15/h1,4-6H,3H2,(H2,11,12,13)
InChI key:InChIKey=ZVKCHPLRXYPLFB-UHFFFAOYSA-N
SMILES:C(=C=CCCl)N1C=2C(=C(N)N=CN2)N=C1
Synonyms:- 9H-Purin-6-amine, 9-(4-chloro-1,2-butadienyl)-
- 9-(4-Chloro-1,2-butadien-1-yl)-9H-purin-6-amine
- 9H-Purin-6-amine, 9-(4-chloro-1,2-butadien-1-yl)-
- 9H-Purin-6-amine, 9-(4-chloro-1,2-butadienyl)-, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
