CymitQuimica logo

CAS 1170133-64-8

:

5′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
5′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position contributes to its acidity and potential reactivity in various chemical reactions. The chlorine atom at the 5′ position and the methoxy group (-OCH3) at the 2′ position introduce specific electronic and steric effects, influencing the compound's chemical behavior and interactions. This compound may exhibit properties such as solubility in organic solvents, potential biological activity, and the ability to participate in substitution reactions due to the presence of the halogen and functional groups. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and interactions will depend on the specific conditions under which it is used.
Formula:C14H11ClO3
InChI:InChI=1S/C14H11ClO3/c1-18-13-6-5-11(15)8-12(13)9-3-2-4-10(7-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=BLCXFSUTKOZWLS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(Cl)C=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 5′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5′-chloro-2′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.