CAS 117021-79-1
:Benzenamine, 2-propyl-, homopolymer
Description:
Benzenamine, 2-propyl-, homopolymer, also known as poly(2-propyl aniline), is a synthetic polymer derived from the polymerization of 2-propylaniline. This compound features a backbone of aromatic amine groups, which contribute to its unique properties. The polymer exhibits good thermal stability and can be processed into various forms, making it suitable for applications in coatings, adhesives, and as a conductive material. Its structure allows for potential interactions with other materials, enhancing adhesion and compatibility in composite systems. Additionally, the presence of amine functional groups can impart basicity, enabling the polymer to participate in various chemical reactions, such as cross-linking or modification with other functional groups. The polymer's solubility can vary depending on its molecular weight and the presence of substituents, influencing its processing and application characteristics. Overall, benzenamine, 2-propyl-, homopolymer is notable for its versatility and potential in advanced material applications.
Formula:(C9H13N)x
InChI:InChI=1S/C9H13N/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7H,2,5,10H2,1H3
InChI key:InChIKey=WKURVXXDGMYSDP-UHFFFAOYSA-N
SMILES:C(CC)C1=C(N)C=CC=C1
Synonyms:- Benzenamine, 2-propyl-, homopolymer
- Poly(2-propylaniline)
- Poly(o-propylaniline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
