CymitQuimica logo

CAS 117022-39-6

:

1,6-dimethylchrysene

Description:
1,6-Dimethylchrysene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused aromatic rings and two methyl groups located at the 1 and 6 positions of the chrysene structure. This compound is typically a solid at room temperature and exhibits a high degree of hydrophobicity due to its extensive aromatic character. It is known for its potential environmental persistence and bioaccumulation, as many PAHs are resistant to degradation. 1,6-Dimethylchrysene may also exhibit mutagenic and carcinogenic properties, similar to other PAHs, which raises concerns regarding its impact on human health and the environment. Its molecular structure contributes to its chemical reactivity, particularly in terms of electrophilic substitution reactions. The compound is primarily of interest in research related to environmental chemistry, toxicology, and the study of combustion byproducts. Safety measures should be taken when handling this substance, as with other PAHs, to minimize exposure and potential health risks.
Formula:C20H16
InChI:InChI=1/C20H16/c1-13-6-5-9-18-16(13)10-11-19-17-8-4-3-7-15(17)14(2)12-20(18)19/h3-12H,1-2H3
SMILES:Cc1cccc2c1ccc1c3ccccc3c(C)cc21
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.