CAS 117043-87-5
:3-hydrazinopyridazine hydrochloride
Description:
3-Hydrazinopyridazine hydrochloride is a chemical compound characterized by its hydrazine and pyridazine functional groups. It typically appears as a white to off-white crystalline solid, which is soluble in water and polar organic solvents due to the presence of the hydrazine moiety. This compound is often utilized in various chemical syntheses and research applications, particularly in the fields of medicinal chemistry and agrochemicals. Its structure allows for potential reactivity in forming various derivatives, making it a valuable intermediate in organic synthesis. The hydrochloride form indicates that it is a salt, which can enhance its stability and solubility compared to its free base form. As with many hydrazine derivatives, it may exhibit biological activity, and thus, safety precautions should be taken when handling it, as hydrazines can be toxic and potentially carcinogenic. Proper storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C4H7ClN4
InChI:InChI=1/C4H6N4.ClH/c5-7-4-2-1-3-6-8-4;/h1-3H,5H2,(H,7,8);1H
SMILES:c1cc(=NN)[nH]nc1.Cl
Synonyms:- Pyridazine, 3-Hydrazinyl-, Hydrochloride (1:1)
- 3-Hydrazinopyridazine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridazine, 3-hydrazinyl-, hydrochloride (1:1)
CAS:Formula:C4H7ClN4Purity:95%Molecular weight:146.57823-Hydrazinopyridazine hydrochloride
CAS:3-Hydrazinopyridazine hydrochlorideFormula:C4H6N4·ClHPurity:95%Color and Shape: off-white crystalline solidMolecular weight:146.58g/mol3-Hydrazinopyridazine hydrochloride
CAS:Formula:C4H7ClN4Purity:97.0%Color and Shape:SolidMolecular weight:146.583-Hydrazinopyridazine hydrochloride
CAS:3-Hydrazinopyridazine hydrochloride is an inorganic compound with the chemical formula (NH)NCl. It is a white solid that is soluble in water and alcohols. 3-Hydrazinopyridazine hydrochloride catalyzes the reduction of various compounds, including hydrazine to ammonia, phosphorus to phosphine, and carbon dioxide to methane. This chemical is used as a catalyst for the synthesis of other compounds. 3-Hydrazinopyridazine hydrochloride also has hypotensive effects and can be used as a pharmaceutical agent.Formula:C4H7ClN4Purity:Min. 95%Molecular weight:146.58 g/mol



