CAS 117046-42-1
:2-(Bicycloheptyl)Dimethylchlorosilane
Description:
2-(Bicycloheptyl)Dimethylchlorosilane is an organosilicon compound characterized by the presence of a silicon atom bonded to two methyl groups and a bicycloheptyl group, along with a chlorine atom. This compound typically exhibits properties common to silanes, such as reactivity with moisture, leading to the formation of silanol groups and siloxane networks. It is generally a colorless to pale yellow liquid with a distinctive odor. The bicycloheptyl moiety contributes to its unique steric and electronic properties, potentially influencing its reactivity and interactions with other chemical species. The presence of the chlorine atom makes it a useful precursor in various chemical syntheses, particularly in the production of silicone polymers and coatings. Additionally, its structure may impart specific characteristics such as hydrophobicity and thermal stability, making it suitable for applications in materials science and surface modification. Safety precautions should be observed when handling this compound, as it may pose health risks through inhalation or skin contact.
Formula:C9H17ClSi
InChI:InChI=1/C9H17ClSi/c1-11(2,10)9-6-7-3-4-8(9)5-7/h7-9H,3-6H2,1-2H3
SMILES:C[Si](C)(C1CC2CCC1C2)Cl
Synonyms:- Bicyclo[2.2.1]hept-2-yl(chloro)dimethylsilane
- Bicyclo[2.2.1]heptane, 2-(chlorodimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.