
CAS 1170461-84-3
:Ethanesulfonamide, 2-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1)
Description:
Ethanesulfonamide, 2-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1), with CAS number 1170461-84-3, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This substance features an ethyl and cyclohexyl substitution on the nitrogen atom of the amine group, contributing to its unique pharmacological profile. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The compound may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity. Further research may be necessary to fully elucidate its biological activity and potential uses in pharmaceuticals or other applications.
Formula:C10H22N2O2S·ClH
InChI:InChI=1S/C10H22N2O2S.ClH/c1-2-12(15(13,14)9-8-11)10-6-4-3-5-7-10;/h10H,2-9,11H2,1H3;1H
InChI key:InChIKey=GNVYONMMMITUMY-UHFFFAOYSA-N
SMILES:N(S(CCN)(=O)=O)(CC)C1CCCCC1.Cl
Synonyms:- Ethanesulfonamide, 2-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.