CAS 117047-08-2

8-β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-3-[4-(β-<smallcap>D</span>-glucopyranosyloxy)phenyl]-7-hydroxy-4H-1-benzopyran-4-one

Description:

The chemical substance known as "8-β-D-Glucopyranosyl-3-[4-(β-D-glucopyranosyloxy)phenyl]-7-hydroxy-4H-1-benzopyran-4-one," with the CAS number 117047-08-2, is a flavonoid glycoside. This compound features a complex structure characterized by multiple sugar moieties, specifically two β-D-glucopyranosyl groups, which enhance its solubility and bioavailability. The presence of hydroxyl groups contributes to its potential antioxidant properties, making it of interest in various biological studies. Flavonoids are known for their diverse pharmacological activities, including anti-inflammatory, anti-cancer, and cardioprotective effects. The specific arrangement of the benzopyran and phenolic structures in this compound may influence its interaction with biological targets, potentially leading to various therapeutic applications. Additionally, the glycosylation pattern can affect its stability and metabolism in biological systems. Overall, this compound represents a significant area of research in natural products chemistry and pharmacognosy, with implications for health and disease management.

Formula: C₂₇H₃₀O₁₄

InChI: InChI=1S/C27H30O14/c28-7-15-19(32)21(34)23(36)26(40-15)17-14(30)6-5-12-18(31)13(9-38-25(12)17)10-1-3-11(4-2-10)39-27-24(37)22(35)20(33)16(8-29)41-27/h1-6,9,15-16,19-24,26-30,32-37H,7-8H2/t15-,16-,19-,20-,21+,22+,23-,24-,26+,27-/m1/s1

InChI key: InChIKey=GZFMKWZQYRIRBD-WIQAIWCDSA-N

SMILES: OC=1C(=C2C(C(=O)C(=CO2)C3=CC=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=CC1)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O

Synonyms:

• Puerarin-4′-O-β-D-glucopyranoside
• Puerarin-4′-O-D-glycoside
• 8-β-D-Glucopyranosyl-3-[4-(β-D-glucopyranosyloxy)phenyl]-7-hydroxy-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 8-β-D-glucopyranosyl-3-[4-(β-D-glucopyranosyloxy)phenyl]-7-hydroxy-
• Puerarin-4′-O-glucoside
• Puerarin Impurity 4

Puerarin-4'-O-β-D-glucopyranoside

CAS: 117047-08-2

Puerarin-4'-O-β-D-glucopyranoside

Purity: ≥98%

Molecular weight: 578.52g/mol

Ref: 54-BUP00281

Puerarin-4''-O-β-D-glucopyranoside

CAS: 117047-08-2

Formula: C₂₇H₃₀O₁₄

Molecular weight: 578.52

Ref: 7W-GY7611

Puerarin-4'-O-β-D-glucopyranoside

CAS: 117047-08-2

Formula: C₂₇H₃₀O₁₄

Purity: 95%~99%

Molecular weight: 578.523

Ref: BP-BP2091

Puerarin-4'-O-β-D-glucopyranoside

CAS: 117047-08-2

Puerarin-4'-O-β-D-glucopyranoside (Puerarin4'-O-glucoside) is a natural product isolated from Pueraria lobata root having estrogenic activity and anti-

Formula: C₂₇H₃₀O₁₄

Purity: 99.88%

Color and Shape: Solid

Molecular weight: 578.52

Ref: TM-T12581

Puerarin-4'-o-β-D-glucopyranoside

CAS: 117047-08-2

Puerarin-4'-o-β-D-glucopyranoside is a glucoside compound, which is derived from the root of the Pueraria genus, commonly known as kudzu. The compound is a secondary metabolite present in several species, most notably Pueraria lobata, and is part of the isoflavonoid class. It demonstrates biological activity primarily through its ability to modulate various signal transduction pathways. This modulation can include antioxidative, anti-inflammatory, and neuroprotective effects, making it a compound of interest for potential therapeutic applications.

Formula: C₂₇H₃₀O₁₄

Purity: Min. 95%

Molecular weight: 578.5 g/mol

Ref: 3D-SEA04708