
CAS 117053-39-1
:N-(1-Methyl-3-phenylpropyl)guanidine
Description:
N-(1-Methyl-3-phenylpropyl)guanidine, identified by its CAS number 117053-39-1, is a chemical compound that belongs to the class of guanidines. This substance features a guanidine functional group, which is characterized by the presence of a carbon atom double-bonded to a nitrogen atom and single-bonded to two other nitrogen atoms. The compound is notable for its structural complexity, incorporating a 1-methyl-3-phenylpropyl moiety, which contributes to its unique properties. Typically, guanidines exhibit basicity due to the presence of nitrogen atoms, which can accept protons. This compound may have applications in various fields, including medicinal chemistry, due to its potential biological activity. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c1-9(14-11(12)13)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H4,12,13,14)
InChI key:InChIKey=TTXDSHGFQDYPFG-UHFFFAOYSA-N
SMILES:C(CC(NC(=N)N)C)C1=CC=CC=C1
Synonyms:- N-(1-Methyl-3-phenylpropyl)guanidine
- Guanidine, N-(1-methyl-3-phenylpropyl)-
- Guanidine, (1-methyl-3-phenylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.