CAS 117057-51-9
:4-amino-N-prop-2-en-1-ylbenzenesulfonamide
Description:
4-Amino-N-prop-2-en-1-ylbenzenesulfonamide, also known by its CAS number 117057-51-9, is an organic compound characterized by the presence of an amino group, a sulfonamide functional group, and a prop-2-en-1-yl side chain attached to a benzene ring. This compound typically exhibits properties associated with both amines and sulfonamides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the amino and sulfonamide groups. The presence of the prop-2-en-1-yl group suggests that it may engage in reactions typical of alkenes, such as electrophilic addition. Its structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as sulfonamides are known for their antibacterial properties. Additionally, the compound may exhibit specific reactivity patterns and biological activities influenced by its functional groups, making it a subject of interest in various chemical and biological research fields.
Formula:C9H12N2O2S
InChI:InChI=1/C9H12N2O2S/c1-2-7-11-14(12,13)9-5-3-8(10)4-6-9/h2-6,11H,1,7,10H2
SMILES:C=CCNS(=O)(=O)c1ccc(cc1)N
Synonyms:- benzenesulfonamide, 4-amino-N-2-propen-1-yl-
- N-Allyl-4-aminobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
