CymitQuimica logo

CAS 117060-55-6

:

4-Amino-N-ethenylbenzamide

Description:
4-Amino-N-ethenylbenzamide, with the CAS number 117060-55-6, is an organic compound characterized by the presence of an amino group (-NH2) and an ethenyl group (-C=C-) attached to a benzamide structure. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The ethenyl group introduces unsaturation, which may contribute to its reactivity, particularly in polymerization reactions or as a building block in organic synthesis. The compound may also display biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic aromatic substitution and addition reactions, due to the functional groups present. Overall, 4-Amino-N-ethenylbenzamide is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-2-11-9(12)7-3-5-8(10)6-4-7/h2-6H,1,10H2,(H,11,12)
InChI key:InChIKey=KRSVYKQJFCLLFH-UHFFFAOYSA-N
SMILES:C(NC=C)(=O)C1=CC=C(N)C=C1
Synonyms:
  • 4-Amino-N-ethenylbenzamide
  • Benzamide, 4-amino-N-ethenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.