
CAS 1170600-64-2
:2-Pyridineethanamine, β,β-dimethyl-, 4-methylbenzenesulfonate (1:1)
Description:
2-Pyridineethanamine, β,β-dimethyl-, 4-methylbenzenesulfonate (1:1), with CAS number 1170600-64-2, is a chemical compound characterized by its structure, which includes a pyridine ring and an amine group, along with a sulfonate moiety. This compound typically exhibits properties associated with both amines and sulfonates, such as solubility in polar solvents and potential reactivity with electrophiles. The presence of the β,β-dimethyl substitution on the ethylamine backbone can influence its steric and electronic properties, potentially affecting its biological activity and interaction with other molecules. The 4-methylbenzenesulfonate group contributes to its overall polarity and may enhance its solubility in aqueous environments. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a reagent in organic synthesis. As with many chemical substances, safety data and handling precautions should be reviewed before use, considering its specific properties and potential hazards.
Formula:C9H14N2·C7H8O3S
InChI:InChI=1S/C9H14N2.C7H8O3S/c1-9(2,7-10)8-5-3-4-6-11-8;1-6-2-4-7(5-3-6)11(8,9)10/h3-6H,7,10H2,1-2H3;2-5H,1H3,(H,8,9,10)
InChI key:InChIKey=SLKNWQGIDKEVRH-UHFFFAOYSA-N
SMILES:C(CN)(C)(C)C1=CC=CC=N1.S(=O)(=O)(O)C1=CC=C(C)C=C1
Synonyms:- 2-Pyridineethanamine, β,β-dimethyl-, 4-methylbenzenesulfonate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.