
CAS 1170608-73-7
:4-Bromo-N,N,3,5-tetramethyl-1H-pyrazole-1-propanamine
Description:
4-Bromo-N,N,3,5-tetramethyl-1H-pyrazole-1-propanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and multiple methyl groups. This compound features a propanamine side chain, contributing to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the bromine atom may impart specific reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The tetramethyl substitution pattern enhances its steric bulk, which can influence its interaction with other molecules. Additionally, the compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its solubility and stability in different solvents can vary, depending on the functional groups present. Overall, 4-Bromo-N,N,3,5-tetramethyl-1H-pyrazole-1-propanamine is a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C10H18BrN3
InChI:InChI=1S/C10H18BrN3/c1-8-10(11)9(2)14(12-8)7-5-6-13(3)4/h5-7H2,1-4H3
InChI key:InChIKey=QMHKOKILDBXDKZ-UHFFFAOYSA-N
SMILES:C(CCN(C)C)N1C(C)=C(Br)C(C)=N1
Synonyms:- 4-Bromo-N,N,3,5-tetramethyl-1H-pyrazole-1-propanamine
- 1H-Pyrazole-1-propanamine, 4-bromo-N,N,3,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.