CAS 117069-75-7
:3-AMINOINDOLIN-2-ONE
Description:
3-Aminoindolin-2-one is an organic compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. The presence of an amino group at the 3-position and a carbonyl group at the 2-position contributes to its reactivity and potential biological activity. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. It may exhibit properties such as being a weak base, which can influence its interactions in various chemical environments. 3-Aminoindolin-2-one has garnered interest in medicinal chemistry, particularly for its potential applications in drug development, as it may act as a scaffold for designing bioactive molecules. Its unique structure allows for various modifications, which can enhance its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, 3-aminoindolin-2-one represents a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C8H9N2O
InChI:InChI=1/C8H8N2O/c9-7-5-3-1-2-4-6(5)10-8(7)11/h1-4,7H,9H2,(H,10,11)/p+1/t7-/m0/s1
Synonyms:- Chembrdg-Bb 4011261
- Akos Bb-9966
- 3-amino-1,3-dihydro-2H-indol-2-one
- (3R)-2-oxo-2,3-dihydro-1H-indol-3-aminium
- (3S)-2-oxo-2,3-dihydro-1H-indol-3-aminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.