CymitQuimica logo

CAS 1170778-26-3

:

3,5-Dimethyl-1-heptanol

Description:
3,5-Dimethyl-1-heptanol is an organic compound classified as a straight-chain alcohol. It features a seven-carbon backbone with two methyl groups located at the 3rd and 5th positions, contributing to its branched structure. This compound is characterized by its hydrophobic nature due to the long hydrocarbon chain, while the hydroxyl (-OH) functional group imparts some degree of polarity, allowing for limited solubility in water. It typically exhibits a moderate boiling point and melting point, reflective of its molecular weight and structure. 3,5-Dimethyl-1-heptanol is likely to have a pleasant, mild odor, making it potentially useful in flavor and fragrance applications. Additionally, it may serve as an intermediate in organic synthesis or as a solvent in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, its unique structure and properties make it an interesting compound in both industrial and research contexts.
Formula:C9H20O
InChI:InChI=1S/C9H20O/c1-4-8(2)7-9(3)5-6-10/h8-10H,4-7H2,1-3H3
InChI key:InChIKey=HBUKPSFSXBTFFW-UHFFFAOYSA-N
SMILES:C(C(CCO)C)C(CC)C
Synonyms:
  • 3,5-Dimethyl-1-heptanol
  • 1-Heptanol, 3,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.