
CAS 117086-92-7
:1H-Indole-1-carbonyl chloride, 3-ethyl-2,3-dihydro-
Description:
1H-Indole-1-carbonyl chloride, 3-ethyl-2,3-dihydro- is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carbonyl chloride functional group, which is indicative of its reactivity, particularly in acylation reactions. The presence of the ethyl group at the 3-position of the indole structure contributes to its unique properties, potentially influencing its solubility and reactivity. As a carbonyl chloride, it is likely to be a reactive intermediate, often used in organic synthesis to introduce acyl groups into various substrates. The compound may exhibit moderate to high toxicity, necessitating careful handling and storage under appropriate conditions. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in organic synthesis, particularly in the development of indole-based derivatives. Overall, this compound exemplifies the diverse chemistry associated with indole derivatives and their utility in synthetic organic chemistry.
Formula:C11H12ClNO
InChI:InChI=1S/C11H12ClNO/c1-2-8-7-13(11(12)14)10-6-4-3-5-9(8)10/h3-6,8H,2,7H2,1H3
InChI key:InChIKey=BYTVMGNFKKBKLJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)N1C=2C(C(CC)C1)=CC=CC2
Synonyms:- 3-Ethyl-2,3-dihydro-1H-indole-1-carbonyl chloride
- 1H-Indole-1-carbonyl chloride, 3-ethyl-2,3-dihydro-
- 3-Ethylindoline-1-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
