CymitQuimica logo

CAS 117086-99-4

:

Phosphonic acid, [[3-(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)propoxy]methyl]-

Description:
Phosphonic acid, specifically the compound with the name "Phosphonic acid, [[3-(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)propoxy]methyl]-" and CAS number 117086-99-4, is a phosphonic acid derivative that features a purine base structure. This compound typically exhibits characteristics common to phosphonic acids, such as the presence of a phosphorus atom bonded to oxygen and carbon, which contributes to its acidic properties. The purine moiety suggests potential biological activity, possibly influencing nucleic acid metabolism or acting as an inhibitor in various biochemical pathways. The presence of an amino group indicates that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly in antiviral or anticancer therapies, due to the purine-like structure that can mimic nucleotides. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable entity in medicinal chemistry and biochemistry.
Formula:C9H14N5O5P
InChI:InChI=1S/C9H14N5O5P/c10-9-12-7-6(8(15)13-9)11-4-14(7)2-1-3-19-5-20(16,17)18/h4H,1-3,5H2,(H2,16,17,18)(H3,10,12,13,15)
InChI key:InChIKey=WYMKPVYTVNNZNW-UHFFFAOYSA-N
SMILES:C(CCOCP(=O)(O)O)N1C2=C(N=C1)C(=O)N=C(N)N2
Synonyms:
  • Phosphonic acid, [[3-(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)propoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.