CAS 1171-49-9

Phenyl(triphenylsilyl)methanone

Description:

Phenyl(triphenylsilyl)methanone, with the CAS number 1171-49-9, is an organosilicon compound characterized by the presence of a phenyl group and a triphenylsilyl moiety attached to a carbonyl functional group. This compound typically exhibits a white to light yellow crystalline appearance and is known for its stability under standard conditions. It is soluble in organic solvents such as dichloromethane and toluene, but generally insoluble in water due to its hydrophobic nature. The presence of the triphenylsilyl group enhances its thermal stability and can influence its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and materials science. Additionally, the carbonyl group contributes to its potential as a reactive intermediate in chemical reactions, such as nucleophilic additions. Overall, Phenyl(triphenylsilyl)methanone is valued for its unique structural features and versatility in chemical transformations.

Formula: C₂₅H₂₀OSi

InChI: InChI=1S/C25H20OSi/c26-25(21-13-5-1-6-14-21)27(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H

InChI key: InChIKey=OGPUONMCKFHQJB-UHFFFAOYSA-N

SMILES: [Si](C(=O)C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4

Synonyms:

• Phenyl(triphenylsilyl)methanone
• Phenyl triphenylsilyl ketone
• Methanone, phenyl(triphenylsilyl)-
• Triphenylbenzoylsilane
• Silane, benzoyltriphenyl-

Methanone, phenyl(triphenylsilyl)-

CAS: 1171-49-9

Formula: C₂₅H₂₀OSi

Molecular weight: 364.5112

Ref: IN-DA000DQ5