CAS 1171028-56-0

Morpholine, 2,6-dimethyl-4-(4-pyridinyl)-, hydrochloride (1:1)

Description:

Morpholine, 2,6-dimethyl-4-(4-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its morpholine backbone, which is a six-membered heterocyclic amine containing one oxygen atom. The presence of two methyl groups at the 2 and 6 positions enhances its lipophilicity, while the 4-(4-pyridinyl) substituent introduces a pyridine ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the nitrogen atoms in both the morpholine and pyridine rings, and it may participate in hydrogen bonding due to the presence of the nitrogen and oxygen atoms. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their roles in medicinal chemistry and as potential therapeutic agents. Safety data and handling precautions should be consulted due to the potential hazards associated with amines and their derivatives.

Formula: C₁₁H₁₆N₂O·ClH

InChI: InChI=1S/C11H16N2O.ClH/c1-9-7-13(8-10(2)14-9)11-3-5-12-6-4-11;/h3-6,9-10H,7-8H2,1-2H3;1H

InChI key: InChIKey=XVWNTLZQVWXJOE-UHFFFAOYSA-N

SMILES: CC1CN(CC(C)O1)C=2C=CN=CC2.Cl

Synonyms:

• Morpholine, 2,6-dimethyl-4-(4-pyridinyl)-, hydrochloride (1:1)