CAS 117106-39-5
:MESO-1,2-BIS(1-NAPHTHYL)ETHYLENEDIAMINE
Description:
MESO-1,2-BIS(1-NAPHTHYL)ETHYLENEDIAMINE, with the CAS number 117106-39-5, is a chiral organic compound notable for its application in asymmetric synthesis and catalysis. This compound features a meso configuration, which means it possesses an internal plane of symmetry, resulting in a non-optically active form despite having multiple chiral centers. It consists of two 1-naphthyl groups attached to a central ethylenediamine backbone, contributing to its unique structural properties. The presence of the naphthyl groups enhances its ability to interact with various substrates, making it useful in enantioselective reactions. Additionally, MESO-1,2-BIS(1-NAPHTHYL)ETHYLENEDIAMINE is often employed in the synthesis of chiral ligands and catalysts in coordination chemistry. Its solubility characteristics can vary depending on the solvent, and it is typically handled with care due to its potential reactivity. Overall, this compound is significant in the field of organic chemistry for its role in facilitating the production of enantiomerically pure compounds.
Formula:C22H22N2
InChI:InChI=1/C22H20N2/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(24)20-14-6-10-16-8-2-4-12-18(16)20/h1-14,21-22H,23-24H2/p+2/t21-,22+
Synonyms:- Salor-Int L300918-1Ea
- Aurora Ka-7324
- 1,2-Di-1-Naphthylethane-1,2-Diamine
- meso-1,2-Bis(naphthyl)ethylenediamine, min. 98%
- (1R,2S)-1,2-dinaphthalen-1-ylethane-1,2-diaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
