CAS 1171069-08-1

Benzenemethanamine, 3,4-dichloro-α-methyl-N-propyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3,4-dichloro-α-methyl-N-propyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and the presence of dichloro substituents on the benzene ring. This compound features a propyl group attached to the nitrogen atom, contributing to its hydrophobic properties. The hydrochloride form indicates that the amine is protonated, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of chlorine atoms on the aromatic ring can influence the compound's reactivity and biological activity, potentially affecting its pharmacokinetic properties. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and exposure, as halogenated compounds can pose specific health risks. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₅Cl₂N·ClH

InChI: InChI=1S/C11H15Cl2N.ClH/c1-3-6-14-8(2)9-4-5-10(12)11(13)7-9;/h4-5,7-8,14H,3,6H2,1-2H3;1H

InChI key: InChIKey=ZWWRVMHAWGIATM-UHFFFAOYSA-N

SMILES: C(NCCC)(C)C1=CC(Cl)=C(Cl)C=C1.Cl

Synonyms:

• Benzenemethanamine, 3,4-dichloro-α-methyl-N-propyl-, hydrochloride (1:1)