CAS 1171123-46-8

1H-Indole, 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-, hydrochloride (1:1)

Description:

1H-Indole, 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 5-position and a methyl group at the 2-position of the indole ring contributes to its unique reactivity and potential biological activity. The compound also features a tetrahydropyridine moiety, which enhances its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. This compound may exhibit various biological activities, making it of interest in drug development and research. Its specific interactions and effects would depend on the context of its use and the biological systems involved. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects.

Formula: C₁₄H₁₅ClN₂·ClH

InChI: InChI=1S/C14H15ClN2.ClH/c1-9-14(10-4-6-16-7-5-10)12-8-11(15)2-3-13(12)17-9;/h2-4,8,16-17H,5-7H2,1H3;1H

InChI key: InChIKey=WWSNDUWIZDYGIQ-UHFFFAOYSA-N

SMILES: CC1=C(C=2C(N1)=CC=C(Cl)C2)C=3CCNCC3.Cl

Synonyms:

• EMD 386088
• 1H-Indole, 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-, hydrochloride (1:1)

EMD386088

CAS: 1171123-46-8

EMD386088

Purity: 98%

Molecular weight: 283.2g/mol

Ref: 54-OR1034259

EMD 386088 Hydrochloride

Controlled Product

CAS: 1171123-46-8

Formula: C₁₄H₁₅ClN₂•(HCl)

Color and Shape: Neat

Molecular weight: 282.06905

Ref: TR-E521033

EMD386088

CAS: 1171123-46-8

EMD386088 is a selective phosphoinositide 3-kinase (PI3K) inhibitor, which is a compound of synthetic origin designed to target specific kinases involved in cell signaling pathways. It functions by selectively inhibiting the activity of PI3K enzymes, which play a critical role in multiple cellular processes, including cell growth, proliferation, and survival. Through its mode of action, EMD386088 disrupts the PI3K/AKT/mTOR signaling pathway, a pivotal regulatory axis often implicated in various malignancies.

Formula: C₁₄H₁₅ClN₂·HCl

Purity: Min. 95%

Molecular weight: 283.2 g/mol

Ref: 3D-WWB12346

EMD 386088 hydrochloride

CAS: 1171123-46-8

EMD 386088 hydrochloride is a 5-HT6 receptor agonist.

Formula: C₁₄H₁₆Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 283.2

Ref: TM-T22763