
CAS 117116-75-3
:Poly(aniline-2-sulfonic acid)
Description:
Poly(aniline-2-sulfonic acid) is a conducting polymer derived from the polymerization of aniline, with the incorporation of sulfonic acid groups that enhance its solubility and conductivity. This substance typically exhibits a high degree of electrical conductivity, making it useful in various applications such as sensors, batteries, and electrochromic devices. The sulfonic acid groups contribute to its water solubility, allowing for easier processing and integration into different matrices. Poly(aniline-2-sulfonic acid) is characterized by its ability to undergo redox reactions, which can be exploited in electrochemical applications. Additionally, it displays good thermal stability and mechanical properties, making it suitable for use in composite materials. The presence of sulfonic acid groups also imparts acid-base properties, enabling it to act as a proton conductor. Overall, this polymer combines the advantageous properties of conducting polymers with enhanced solubility and functionality due to its sulfonic acid modifications.
Formula:(C6H7NO3S)x
InChI:InChI=1S/C6H7NO3S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,7H2,(H,8,9,10)
InChI key:InChIKey=ZMCHBSMFKQYNKA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(N)C=CC=C1
Synonyms:- Orthanilic acid homopolymer
- o-Aminobenzenesulfonic acid polymer
- o-Aminobenzenesulfonic acid homopolymer
- Poly(o-aminobenzenesulfonic acid)
- Benzenesulfonic acid, 2-amino-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
