CAS 1171331-39-7
:Acetamide, 2-amino-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)
Description:
Acetamide, 2-amino-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a trifluoroethyl group, contributing to its unique properties, including increased lipophilicity and potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its stability and reactivity. Typically, compounds with trifluoromethyl groups exhibit distinctive electronic properties, making them of interest in medicinal chemistry and agrochemicals. The presence of the amino group suggests potential for hydrogen bonding, which can affect the compound's interaction with biological targets. This compound may be studied for its pharmacological properties, particularly in relation to its potential as a drug candidate or in biochemical applications. As with any chemical, safety data and handling precautions should be observed, given the presence of fluorinated groups which can pose specific environmental and health risks.
Formula:C4H7F3N2O·ClH
InChI:InChI=1S/C4H7F3N2O.ClH/c5-4(6,7)2-9-3(10)1-8;/h1-2,8H2,(H,9,10);1H
InChI key:InChIKey=DBNFKWRZLGVLSH-UHFFFAOYSA-N
SMILES:N(C(CN)=O)CC(F)(F)F.Cl
Synonyms:- Acetamide, 2-amino-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)
- 2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride, 97%
CAS:<p>Reactant in the synthesis of isoxazoline indolizine amides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has</p>Formula:C4H7N2OF3•HClPurity:97%Molecular weight:192.57Acetamide, 2-amino-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)
CAS:Formula:C4H8ClF3N2OPurity:97%Color and Shape:SolidMolecular weight:192.5673Ref: IN-DA000DRN
1g29.00€5g52.00€10g69.00€1kg611.00€25g74.00€2kgTo inquire100g142.00€500g292.00€250mg25.00€2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride
CAS:2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloridePurity:98%Color and Shape:SolidMolecular weight:192.57g/mol2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride
CAS:Formula:C4H8ClF3N2OPurity:95%Color and Shape:SolidMolecular weight:192.572-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride
CAS:<p>Versatile small molecule scaffold</p>Formula:C4H7F3N2O·HClPurity:Min. 95%Molecular weight:192.57 g/mol2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride
CAS:2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride is a useful organic compound for research related to life sciences. The catalog number is T66533 and the CAS number is 1171331-39-7.Formula:C4H8ClF3N2OColor and Shape:SolidMolecular weight:192.57






