CAS 117137-85-6
:val-pro-asp-pro-arg
Description:
Val-pro-asp-pro-arg, also known as a peptide, is a synthetic compound composed of a sequence of amino acids: valine (Val), proline (Pro), aspartic acid (Asp), proline (Pro), and arginine (Arg). This specific sequence contributes to its unique properties and potential biological activities. Peptides like val-pro-asp-pro-arg are often studied for their roles in various physiological processes, including signaling pathways and cellular interactions. The presence of proline in the sequence can influence the peptide's conformation and stability, while the charged side chains of aspartic acid and arginine may affect its solubility and interaction with other biomolecules. Val-pro-asp-pro-arg may also exhibit specific biological activities, such as antimicrobial or immunomodulatory effects, making it of interest in pharmaceutical and biotechnological applications. As with many peptides, its stability and efficacy can be influenced by factors such as pH, temperature, and the presence of enzymes. Further research is often necessary to fully elucidate its potential uses and mechanisms of action.
Formula:C25H42N8O8
InChI:InChI=1S/C25H42N8O8/c1-13(2)19(26)23(39)33-11-5-8-17(33)21(37)31-15(12-18(34)35)22(38)32-10-4-7-16(32)20(36)30-14(24(40)41)6-3-9-29-25(27)28/h13-17,19H,3-12,26H2,1-2H3,(H,30,36)(H,31,37)(H,34,35)(H,40,41)(H4,27,28,29)/t14-,15-,16-,17-,19-/m0/s1
InChI key:KONFXBWESLMOCK-WSRJKRBPSA-N
SMILES:CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)N
Synonyms:- Enterostatin (pig, rat)
- H-Val-Pro-Asp-Pro-Arg-OH
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Enterostatin (rat)
CAS:Enterostatin (rat), an oral procolipase peptide, cuts fat intake and cholesterol via CCK1 receptor.Formula:C25H42N8O8Molecular weight:582.65
