CymitQuimica logo

CAS 117141-31-8

:

3-(2'-pyridyldithio)benzyldiazoacetate

Description:
3-(2'-Pyridyldithio)benzyldiazoacetate is a chemical compound characterized by its unique structural features, which include a diazoacetate functional group and a pyridyldithio moiety. The presence of the diazo group (-N=N-) imparts notable reactivity, making it useful in various organic synthesis applications, particularly in the formation of azo compounds. The pyridyldithio component contributes to the compound's potential for coordination with metal ions, enhancing its utility in coordination chemistry and catalysis. Additionally, the compound may exhibit interesting photochemical properties due to the presence of the diazo group, which can undergo thermal or photolytic decomposition. Its solubility and stability in different solvents can vary, influencing its application in laboratory settings. Overall, 3-(2'-pyridyldithio)benzyldiazoacetate is a versatile compound with potential applications in organic synthesis, materials science, and coordination chemistry, making it a subject of interest for researchers in these fields.
Formula:C14H11N3O2S2
InChI:InChI=1/C14H11N3O2S2/c15-17-9-14(18)19-10-11-4-3-5-12(8-11)20-21-13-6-1-2-7-16-13/h1-9H,10H2/b14-9+
Synonyms:
  • m-(2'-Pyridyldithio)benzyldiazoacetate
  • (E)-2-diazonio-1-{[3-(pyridin-2-yldisulfanyl)benzyl]oxy}ethenolate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.