CAS 1171521-16-6

2-Furancarboxamide, N-[3-(aminomethyl)phenyl]-, hydrochloride (1:1)

Description:

2-Furancarboxamide, N-[3-(aminomethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a furan ring and an amide functional group. The presence of the aminomethyl group attached to a phenyl ring contributes to its potential biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in medicinal chemistry due to its structural features. Its molecular interactions could be influenced by the furan moiety, which is known for its reactivity and ability to participate in various chemical reactions. Additionally, the compound's stability, melting point, and solubility characteristics would be important for its practical applications, particularly in drug formulation and delivery systems. Overall, this compound represents a blend of organic chemistry and potential therapeutic utility.

Formula: C₁₂H₁₂N₂O₂·ClH

InChI: InChI=1S/C12H12N2O2.ClH/c13-8-9-3-1-4-10(7-9)14-12(15)11-5-2-6-16-11;/h1-7H,8,13H2,(H,14,15);1H

InChI key: InChIKey=QBFLZPSQLPPPKG-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CO1)C2=CC(CN)=CC=C2.Cl

Synonyms:

• 2-Furancarboxamide, N-[3-(aminomethyl)phenyl]-, hydrochloride (1:1)