CAS 1171529-01-3
:7-Amino-2,3-dihydro-3,3-dimethyl-5-propyl-1,5-benzoxazepin-4(5H)-one
Description:
7-Amino-2,3-dihydro-3,3-dimethyl-5-propyl-1,5-benzoxazepin-4(5H)-one is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazepine moiety. This compound features an amino group, contributing to its potential as a bioactive molecule. The presence of dimethyl and propyl substituents on the bicyclic framework influences its solubility and lipophilicity, which are critical for pharmacological activity. The compound's structure suggests it may interact with biological targets, potentially exhibiting properties such as neuroactivity or other therapeutic effects. Its CAS number, 1171529-01-3, allows for precise identification in chemical databases. While specific physical and chemical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this class often exhibit moderate to high stability under standard conditions. Further studies would be necessary to elucidate its full range of biological activities and potential applications in medicinal chemistry.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-4-7-16-11-8-10(15)5-6-12(11)18-9-14(2,3)13(16)17/h5-6,8H,4,7,9,15H2,1-3H3
InChI key:InChIKey=PKILWPMXPHSQBW-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(OCC(C)(C)C1=O)=CC=C(N)C2
Synonyms:- 7-Amino-2,3-dihydro-3,3-dimethyl-5-propyl-1,5-benzoxazepin-4(5H)-one
- 1,5-Benzoxazepin-4(5H)-one, 7-amino-2,3-dihydro-3,3-dimethyl-5-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.