CAS 117162-85-3
:4-METHOXY-2-NITROPHENYL ISOCYANATE 97
Description:
4-Methoxy-2-nitrophenyl isocyanate, with the CAS number 117162-85-3, is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a phenyl ring that also features a methoxy group (-OCH3) and a nitro group (-NO2) at specific positions. This compound typically appears as a yellow to orange solid and is known for its reactivity, particularly in nucleophilic addition reactions due to the electrophilic nature of the isocyanate group. It is used in various applications, including the synthesis of pharmaceuticals and agrochemicals, as well as in materials science for the development of polymers. The presence of the methoxy and nitro substituents can influence its chemical behavior, solubility, and reactivity. Safety precautions are essential when handling this compound, as isocyanates can be hazardous, posing risks such as respiratory irritation and sensitization. Proper storage and handling protocols should be followed to mitigate potential risks associated with exposure.
Formula:C8H6N2O4
InChI:InChI=1/C8H6N2O4/c1-14-6-2-3-7(9-5-11)8(4-6)10(12)13/h2-4H,1H3
SMILES:COc1ccc(c(c1)N(=O)=O)N=C=O
Synonyms:- Benzene, 1-isocyanato-4-methoxy-2-nitro- (9CI)
- 1-Isocyanato-4-Methoxy-2-Nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
