CAS 1171622-87-9
:6-Amino-5-bromo-3-pyridinecarboxamide
Description:
6-Amino-5-bromo-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the pyridine ring, contributing to its potential as a building block in pharmaceutical synthesis. The presence of a bromine atom at the 5-position of the pyridine enhances its reactivity and may influence its biological activity. The molecular structure suggests that it could participate in hydrogen bonding due to the amino and carboxamide functionalities, which may affect its solubility and interaction with biological targets. Additionally, the compound's properties, such as melting point, solubility, and stability, would be influenced by the substituents on the pyridine ring. Overall, 6-Amino-5-bromo-3-pyridinecarboxamide is of interest in medicinal chemistry and may have applications in drug development or as a research tool in various biochemical studies.
Formula:C6H6BrN3O
InChI:InChI=1S/C6H6BrN3O/c7-4-1-3(6(9)11)2-10-5(4)8/h1-2H,(H2,8,10)(H2,9,11)
InChI key:InChIKey=OIQGWDAWZBDVNI-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=C(Br)C(N)=NC1
Synonyms:- 6-Amino-5-bromo-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 6-amino-5-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.