CymitQuimica logo

CAS 117168-59-9

:

(2S,3S,4R)-2-azidooctadecane-1,3,4-triol

Description:
(2S,3S,4R)-2-azidooctadecane-1,3,4-triol is a complex organic compound characterized by its long-chain structure, which includes an azido group (-N3) and multiple hydroxyl groups (-OH) on a saturated fatty acid backbone. The stereochemistry indicated by the (2S,3S,4R) configuration suggests specific spatial arrangements of the substituents around the chiral centers, which can significantly influence the compound's reactivity and biological activity. The presence of the azido group makes it a potential candidate for click chemistry applications, allowing for further functionalization. The triol nature of the molecule indicates that it has three hydroxyl groups, which can participate in hydrogen bonding and enhance its solubility in polar solvents. This compound may exhibit interesting properties in biochemical contexts, particularly in the development of pharmaceuticals or as a biochemical probe. However, detailed studies would be necessary to fully understand its behavior, stability, and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C18H37N3O3
InChI:InChI=1/C18H37N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(23)18(24)16(15-22)20-21-19/h16-18,22-24H,2-15H2,1H3/t16-,17+,18-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.