CAS 1171728-14-5

2-Quinolinamine, 6-bromo-3-methyl-, hydrochloride (1:1)

Description:

2-Quinolinamine, 6-bromo-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. The presence of a bromine atom at the 6-position and a methyl group at the 3-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound may exhibit properties such as antimicrobial or antitumor activity, common among substituted quinolines. Its molecular interactions can be influenced by the bromine and methyl substituents, affecting its pharmacokinetics and mechanism of action. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, 2-Quinolinamine, 6-bromo-3-methyl-, hydrochloride is of interest in research for its potential therapeutic applications and as a building block in the synthesis of more complex molecules.

Formula: C₁₀H₉BrN₂·ClH

InChI: InChI=1S/C10H9BrN2.ClH/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12;/h2-5H,1H3,(H2,12,13);1H

InChI key: InChIKey=AMMCNIUMBAUXPY-UHFFFAOYSA-N

SMILES: CC1=CC2=C(N=C1N)C=CC(Br)=C2.Cl

Synonyms:

• 2-Quinolinamine, 6-bromo-3-methyl-, hydrochloride (1:1)

2-Amino-6-bromo-3-methylquinoline hydrochloride

CAS: 1171728-14-5

Formula: C₁₀H₁₀BrClN₂

Molecular weight: 273.5568

Ref: IN-DA000DTP

2-Amino-6-bromo-3-methylquinoline hydrochloride

CAS: 1171728-14-5

2-Amino-6-bromo-3-methylquinoline hydrochloride

Purity: ≥95%

Molecular weight: 273.56g/mol

Ref: 54-OR308238