CAS 117174-87-5
:N-(2,4,5-Trimethylphenyl)thiourea
Description:
N-(2,4,5-Trimethylphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen. This compound features a trimethyl-substituted phenyl group, indicating that three methyl groups are attached to the aromatic ring at the 2, 4, and 5 positions. The presence of these substituents can influence the compound's solubility, reactivity, and overall chemical behavior. Typically, thioureas exhibit properties such as moderate to high stability under standard conditions, and they can participate in various chemical reactions, including nucleophilic substitutions and cyclizations. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its specific applications and interactions would depend on the context of its use, including potential roles in synthesis or as a reagent in chemical reactions. Safety data and handling precautions should be considered due to the potential toxicity associated with thiourea derivatives.
Formula:C10H14N2S
InChI:InChI=1S/C10H14N2S/c1-6-4-8(3)9(5-7(6)2)12-10(11)13/h4-5H,1-3H3,(H3,11,12,13)
InChI key:InChIKey=QVCQPIJMAAOGKX-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=C(C)C=C(C)C(C)=C1
Synonyms:- (2,4,5-Trimethylphenyl)thiourea
- 1-(2,4,5-Trimethylphenyl)thiourea
- N-(2,4,5-Trimethylphenyl)thiourea
- NSC 201482
- Thiourea, (2,4,5-trimethylphenyl)-
- Thiourea, N-(2,4,5-trimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(2,4,5-Trimethylphenyl)-2-thiourea
CAS:1-(2,4,5-Trimethylphenyl)-2-thiourea
Molecular weight:194.29656g/mol


