CAS 1171825-25-4

4-(2-Bromo-4-fluorophenyl)-2-pyrrolidinone

Description:

4-(2-Bromo-4-fluorophenyl)-2-pyrrolidinone is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring and a substituted phenyl group. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidinone moiety, which is often associated with various biological activities. The compound's characteristics, including its melting point, boiling point, and spectral properties, would be determined through experimental methods and may vary based on purity and environmental conditions. As with many halogenated compounds, it may also exhibit specific interactions with biological systems, making it of interest for further research in drug development and chemical synthesis.

Formula: C₁₀H₉BrFNO

InChI: InChI=1S/C10H9BrFNO/c11-9-4-7(12)1-2-8(9)6-3-10(14)13-5-6/h1-2,4,6H,3,5H2,(H,13,14)

InChI key: InChIKey=HFVUVLTULCWVBX-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC(F)=C1)C2CC(=O)NC2

Synonyms:

• 2-Pyrrolidinone, 4-(2-bromo-4-fluorophenyl)-
• 4-(2-Bromo-4-fluorophenyl)-2-pyrrolidinone