CAS 117184-53-9
:2,4-DODECADIENAMIDE, N-(DIHYDRO-5'-HYDROXY-6'-OXOSPIRO(4,8-DIOXATRICYCLO(5.1.0.03,5)OCTANE-2,2'(3'H)-FURAN)-4'-YL)-4,6-DIMETHYL-
Description:
2,4-Dodecadienamide, N-(dihydro-5'-hydroxy-6'-oxospiro(4,8-dioxatricyclo(5.1.0.03,5)octane-2,2'(3'H)-furan)-4'-yl)-4,6-dimethyl- is a complex organic compound characterized by its unique structural features, including multiple functional groups and a bicyclic framework. The presence of the dodecadienamide moiety suggests it may exhibit properties typical of unsaturated amides, such as reactivity in various chemical transformations. The spirocyclic structure contributes to its potential biological activity, possibly influencing its interactions with biological targets. The compound's hydroxyl and carbonyl groups may enhance its solubility and reactivity, making it suitable for applications in pharmaceuticals or agrochemicals. Its intricate structure indicates potential for diverse applications, but specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.
Formula:C23H33NO6
InChI:InChI=1/C23H33NO6/c1-4-5-6-7-8-13(2)11-14(3)9-10-16(25)24-15-12-23(30-22(15)27)20-18(28-20)17(26)19-21(23)29-19/h9-11,13,15,18-22,27H,4-8,12H2,1-3H3,(H,24,25)/b10-9+,14-11+/t13-,15?,18-,19+,20-,21+,22?,23?/m1/s1
Synonyms:- 2,4-Dodecadienamide,N-(Dihydro-5’-Hydroxy-6-Oxospiro(4,8-Dioxatricyclo(5.1.0.0
- 5))Octane-2,2’(3’H)-Furan)-4’-Yl)-4,6-Dimethyl-(Sup
- Aranorosine
- Aranorosin
- Aranorosin A
- (2E,4E,6R)-N-[(1R,3S,5R,7S)-5'-hydroxy-6-oxodihydro-3'H-spiro[4,8-dioxatricyclo[5.1.0.0~3,5~]octane-2,2'-furan]-4'-yl]-4,6-dimethyldodeca-2,4-dienamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Aranorosin
CAS:<p>Aranorosin, from P. roseus, is antimicrobial at 1mg/ml and reduces HeLa/Bcl-2 cell viability.</p>Formula:C23H33NO6Color and Shape:SolidMolecular weight:419.518

