CAS 117186-02-4

3-METHYL-5-(TRIFLUOROMETHYL)BENZOIC ACID

Description:

3-Methyl-5-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a methyl group and a trifluoromethyl group attached to a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH), which imparts acidic properties to the compound. The trifluoromethyl group (-CF3) is known for its electron-withdrawing effects, which can influence the acidity and reactivity of the compound. This substance is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique substituents can enhance its utility in various chemical reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms can impart distinctive physical and chemical properties, such as increased lipophilicity and stability. Safety data should be consulted for handling and storage, as the trifluoromethyl group can also affect toxicity and environmental impact. Overall, 3-methyl-5-(trifluoromethyl)benzoic acid is a compound of interest in both research and industrial applications.

Formula: C₉H₇F₃O₂

InChI: InChI=1/C9H7F3O2/c1-5-2-6(8(13)14)4-7(3-5)9(10,11)12/h2-4H,1H3,(H,13,14)

SMILES: Cc1cc(cc(c1)C(F)(F)F)C(=O)O

Synonyms:

• Rarechem Al Bo 2140

Benzoic acid, 3-methyl-5-(trifluoromethyl)-

CAS: 117186-02-4

Formula: C₉H₇F₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.1459

Ref: IN-DA000DVO

3-Methyl-5-(trifluoromethyl)benzoic acid

CAS: 117186-02-4

3-Methyl-5-(trifluoromethyl)benzoic acid

Formula: C₉H₇F₃O₂

Purity: 99%

Color and Shape: white powder

Molecular weight: 204.15g/mol

Ref: 54-PC0448

3-Methyl-5-(trifluoromethyl)benzoic acid

CAS: 117186-02-4

Formula: C₉H₇F₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.148

Ref: 10-F237368