CymitQuimica logo

CAS 117186-21-7

:

7-Chloro-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid

Description:
7-Chloro-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its complex ring structure, which includes both imidazole and pyrimidine moieties. This compound features a chlorine atom at the 7-position and a methyl group at the 5-position of the imidazo ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 2-position enhances its acidity and potential reactivity, making it a candidate for various chemical reactions and applications. It is often studied in the context of medicinal chemistry and biochemistry due to its potential biological activity. The compound's molecular structure allows for interactions with biological targets, which may lead to pharmacological effects. Additionally, its stability and solubility characteristics can vary based on environmental conditions, influencing its behavior in biological systems. Overall, 7-Chloro-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid is of interest for its structural features and potential applications in research and development.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-4-10-6(9)2-7-11-5(8(13)14)3-12(4)7/h2-3H,1H3,(H,13,14)
InChI key:InChIKey=XESHUXVEPZGKHS-UHFFFAOYSA-N
SMILES:CC=1N2C(=NC(C(O)=O)=C2)C=C(Cl)N1
Synonyms:
  • Imidazo[1,2-c]pyrimidine-2-carboxylic acid, 7-chloro-5-methyl-
  • 7-Chloro-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.