CAS 117186-54-6
:Butanediolbistrifluoroethanesulfonate; 98%
Description:
Butanediolbistrifluoroethanesulfonate, with the CAS number 117186-54-6, is a chemical compound characterized by its sulfonate ester functional groups. It is typically used as a reagent in organic synthesis, particularly in the field of medicinal chemistry and materials science. The presence of trifluoroethanesulfonate groups imparts unique properties, such as increased solubility in polar solvents and enhanced reactivity, making it valuable for various chemical transformations. This compound is often utilized in the preparation of complex molecules, including pharmaceuticals and agrochemicals. It is important to handle this substance with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use. Additionally, its stability under standard laboratory conditions allows for its application in diverse synthetic pathways. Overall, butanediolbistrifluoroethanesulfonate is a versatile reagent with significant utility in advanced chemical research and development.
Formula:C8H12F6O6S2
InChI:InChI=1/C8H12F6O6S2/c9-7(10,11)5-21(15,16)19-3-1-2-4-20-22(17,18)6-8(12,13)14/h1-6H2
SMILES:C(CCOS(=O)(=O)CC(F)(F)F)COS(=O)(=O)CC(F)(F)F
Synonyms:- 1,4-Butanediol bis(2,2,2-trifluoroethanesulfonate)
- Butane-1,4-Diyl Bis(2,2,2-Trifluoroethanesulfonate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
