CAS 1171891-09-0

3-(4-Methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:

3-(4-Methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a methoxyphenyl group and a boron-containing dioxaborolane moiety. The presence of the methoxy group enhances its solubility and may influence its electronic properties, while the dioxaborolane unit is notable for its potential applications in organic synthesis and as a reagent in cross-coupling reactions. This compound is likely to exhibit moderate to high stability under standard conditions, although its reactivity can be influenced by the presence of the boron atom, which can participate in various chemical transformations. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of organic electronic devices or as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.

Formula: C₁₈H₂₂BNO₃

InChI: InChI=1S/C18H22BNO3/c1-17(2)18(3,4)23-19(22-17)15-10-14(11-20-12-15)13-6-8-16(21-5)9-7-13/h6-12H,1-5H3

InChI key: InChIKey=XLFWSSZQZYJZNZ-UHFFFAOYSA-N

SMILES: CC1(C)OB(C=2C=C(C=NC2)C3=CC=C(OC)C=C3)OC1(C)C

Synonyms:

• Pyridine, 3-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 3-(4-Methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
• 3-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridine