
CAS 1171891-27-2
:3-(Acetylamino)-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanamide
Description:
3-(Acetylamino)-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanamide is a chemical compound characterized by its complex structure, which includes an acetylamino group and a pyridine ring substituted with a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. This compound is likely to exhibit moderate to high solubility in organic solvents, and its polar functional groups may contribute to its interaction with biological systems. The amide linkage indicates potential for hydrogen bonding, which can influence its pharmacokinetic properties. Additionally, the presence of the pyridine ring may impart specific electronic properties, making it a candidate for further investigation in the context of enzyme inhibition or receptor binding. Overall, this compound's unique structural features position it as a potentially valuable entity in chemical research and pharmaceutical applications.
Formula:C16H24BN3O4
InChI:InChI=1S/C16H24BN3O4/c1-11(21)19-7-6-14(22)20-13-8-12(9-18-10-13)17-23-15(2,3)16(4,5)24-17/h8-10H,6-7H2,1-5H3,(H,19,21)(H,20,22)
InChI key:InChIKey=ZWFXJPQTOCIPME-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(NC(CCNC(C)=O)=O)C=NC2
Synonyms:- 3-(Acetylamino)-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanamide
- Propanamide, 3-(acetylamino)-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-
- 3-acetylamino-N-[5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridin-3-yl]propionamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(3-Acetamidopropanamido)pyridine-3-boronic acid pinacol ester
CAS:Formula:C16H24BN3O4Molecular weight:333.1905
