CAS 1171917-16-0

1,2-Dihydro-2-oxo-1-[2-oxo-2-(2-thiazolylamino)ethyl]-3-pyridinecarboxylic acid

Description:

1,2-Dihydro-2-oxo-1-[2-oxo-2-(2-thiazolylamino)ethyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thiazole moiety, and multiple functional groups such as carboxylic acid and ketone. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen and sulfur in its rings. It exhibits properties that may include solubility in polar solvents, potential biological activity, and the ability to participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The thiazole group may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests that it could serve as a versatile intermediate in organic synthesis or as a lead compound in drug development. Its specific applications and reactivity would depend on further studies and characterization, including its stability, reactivity under different conditions, and interactions with biological targets.

Formula: C₁₁H₉N₃O₄S

InChI: InChI=1S/C11H9N3O4S/c15-8(13-11-12-3-5-19-11)6-14-4-1-2-7(9(14)16)10(17)18/h1-5H,6H2,(H,17,18)(H,12,13,15)

InChI key: InChIKey=KKXUFRZWLLQGSH-UHFFFAOYSA-N

SMILES: C(C(NC1=NC=CS1)=O)N2C(=O)C(C(O)=O)=CC=C2

Synonyms:

• 1,2-Dihydro-2-oxo-1-[2-oxo-2-(2-thiazolylamino)ethyl]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-1-[2-oxo-2-(2-thiazolylamino)ethyl]-