CymitQuimica logo

CAS 1171917-26-2

:

2-Chloro-4-fluoro-3-methoxybenzenepropanoic acid

Description:
2-Chloro-4-fluoro-3-methoxybenzenepropanoic acid, identified by its CAS number 1171917-26-2, is an aromatic compound featuring a benzene ring substituted with a chlorine atom, a fluorine atom, and a methoxy group, along with a propanoic acid moiety. This compound exhibits characteristics typical of halogenated aromatic acids, including potential acidity due to the carboxylic acid functional group. The presence of the chlorine and fluorine substituents can influence its reactivity, polarity, and solubility in various solvents. The methoxy group contributes to the compound's overall electronic properties, potentially affecting its interaction with biological systems and its utility in synthetic applications. Such compounds may be of interest in pharmaceuticals, agrochemicals, or materials science due to their unique structural features and potential biological activities. Additionally, the specific arrangement of substituents can lead to distinct physical properties, such as melting and boiling points, which are essential for practical applications and further research.
Formula:C10H10ClFO3
InChI:InChI=1S/C10H10ClFO3/c1-15-10-7(12)4-2-6(9(10)11)3-5-8(13)14/h2,4H,3,5H2,1H3,(H,13,14)
InChI key:InChIKey=XSBZMDZEWDUDHG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(Cl)C(OC)=C(F)C=C1
Synonyms:
  • 2-Chloro-4-fluoro-3-methoxybenzenepropanoic acid
  • Benzenepropanoic acid, 2-chloro-4-fluoro-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.