CAS 1171917-62-6

4-Bromo-2-[4-(phenylmethyl)-1-piperazinyl]phenol

Description:

4-Bromo-2-[4-(phenylmethyl)-1-piperazinyl]phenol is a chemical compound characterized by its complex structure, which includes a bromine atom, a phenolic hydroxyl group, and a piperazine moiety. This compound features a biphenyl framework, where one of the phenyl rings is substituted with a piperazine group that is further substituted with a phenylmethyl group. The presence of the bromine atom enhances its reactivity and may influence its biological activity. The hydroxyl group contributes to its potential as a ligand in various chemical reactions and biological interactions. This compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the piperazine's common use in drug design. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₇H₁₉BrN₂O

InChI: InChI=1S/C17H19BrN2O/c18-15-6-7-17(21)16(12-15)20-10-8-19(9-11-20)13-14-4-2-1-3-5-14/h1-7,12,21H,8-11,13H2

InChI key: InChIKey=LVNDXAIWQWQVBR-UHFFFAOYSA-N

SMILES: OC1=C(C=C(Br)C=C1)N2CCN(CC3=CC=CC=C3)CC2

Synonyms:

• Phenol, 4-bromo-2-[4-(phenylmethyl)-1-piperazinyl]-
• 4-Bromo-2-[4-(phenylmethyl)-1-piperazinyl]phenol